C20H16N2O7 — CID 7951282
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 7951282) has the molecular formula C20H16N2O7 and a molecular weight of 396.36 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 7951282 |
| Molecular Formula | C20H16N2O7 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H16N2O7/c1-28-15-9-5-4-8-14(15)18(25)21-16(23)11-29-17(24)10-22-19(26)12-6-2-3-7-13(12)20(22)27/h2-9H,10-11H2,1H3,(H,21,23,25) |
| InChIKey | FETZYDJQKAFENO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|