C17H15NO6 — CID 2624849
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 4-hydroxybenzoate (PubChem CID 2624849) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 4-hydroxybenzoate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 2624849 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 4-hydroxybenzoate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H15NO6/c1-23-14-5-3-2-4-13(14)16(21)18-15(20)10-24-17(22)11-6-8-12(19)9-7-11/h2-9,19H,10H2,1H3,(H,18,20,21) |
| InChIKey | WNSPYJOIKICXQX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |