C21H17NO6 — CID 2558836
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 1-hydroxynaphthalene-2-carboxylate (PubChem CID 2558836) has the molecular formula C21H17NO6 and a molecular weight of 379.37 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 1-hydroxynaphthalene-2-carboxylate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 1-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 2558836 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 1-hydroxynaphthalene-2-carboxylate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C21H17NO6/c1-27-17-9-5-4-8-15(17)20(25)22-18(23)12-28-21(26)16-11-10-13-6-2-3-7-14(13)19(16)24/h2-11,24H,12H2,1H3,(H,22,23,25) |
| InChIKey | YNWOPVSOGKAJAE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |