C20H16N2O5 — CID 2558637
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 1-hydroxynaphthalene-2-carboxylate (PubChem CID 2558637) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 1-hydroxynaphthalene-2-carboxylate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 1-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 2558637 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 1-hydroxynaphthalene-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2ccccc2c1O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16N2O5/c23-17(21-22-19(25)14-7-2-1-3-8-14)12-27-20(26)16-11-10-13-6-4-5-9-15(13)18(16)24/h1-11,24H,12H2,(H,21,23)(H,22,25) |
| InChIKey | HKWHEUYZSCKWLW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|