About (3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate
(3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate (PubChem CID 958586) has the molecular formula C17H18O4
and a molecular weight of 286.33 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate.
Analyze (3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate?
The IUPAC name of (3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate (CID 958586) is (3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate.
What is the SMILES notation for (3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate?
The canonical SMILES for (3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate is CC(C)(C)C(=O)COC(=O)c1ccc2ccccc2c1O.
What is the InChIKey of (3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate?
The InChIKey is DMQIAZRUPDYWEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O4/c1-17(2,3)14(18)10-21-16(20)13-9-8-11-6-4-5-7-12(11)15(13)19/h4-9,19H,10H2,1-3H3.
What are the key properties of (3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate?
(3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate has a molecular weight of 286.33 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-2-oxobutyl) 1-hydroxynaphthalene-2-carboxylate is sourced from PubChem (CID 958586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).