About (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate
(4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate (PubChem CID 163643445) has the molecular formula C18H14O4
and a molecular weight of 294.31 g/mol. Its IUPAC name is (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate |
| PubChem CID | 163643445 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate |
| SMILES | O=C(OCc1ccc(O)cc1)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C18H14O4/c19-14-8-5-12(6-9-14)11-22-18(21)16-10-7-13-3-1-2-4-15(13)17(16)20/h1-10,19-20H,11H2 |
| InChIKey | IGGFWEYUNOFDRX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate?
The IUPAC name of (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate (CID 163643445) is (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate.
What is the SMILES notation for (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate?
The canonical SMILES for (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate is O=C(OCc1ccc(O)cc1)c1ccc2ccccc2c1O.
What is the InChIKey of (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate?
The InChIKey is IGGFWEYUNOFDRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O4/c19-14-8-5-12(6-9-14)11-22-18(21)16-10-7-13-3-1-2-4-15(13)17(16)20/h1-10,19-20H,11H2.
What are the key properties of (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate?
(4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate has a molecular weight of 294.31 g/mol, XLogP of 3.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyphenyl)methyl 1-hydroxynaphthalene-2-carboxylate is sourced from PubChem (CID 163643445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).