C21H20N2O4 — CID 1372554
N'-[2-(3,5-dimethylphenoxy)acetyl]-1-hydroxynaphthalene-2-carbohydrazide (PubChem CID 1372554) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylphenoxy)acetyl]-1-hydroxynaphthalene-2-carbohydrazide.
| Compound Name | N'-[2-(3,5-dimethylphenoxy)acetyl]-1-hydroxynaphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 1372554 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N'-[2-(3,5-dimethylphenoxy)acetyl]-1-hydroxynaphthalene-2-carbohydrazide |
| SMILES | Cc1cc(C)cc(OCC(=O)NNC(=O)c2ccc3ccccc3c2O)c1 |
| InChI | InChI=1S/C21H20N2O4/c1-13-9-14(2)11-16(10-13)27-12-19(24)22-23-21(26)18-8-7-15-5-3-4-6-17(15)20(18)25/h3-11,25H,12H2,1-2H3,(H,22,24)(H,23,26) |
| InChIKey | VRFWCRVWBJNNHM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|