C20H16O3 — CID 939829
1-(1-hydroxynaphthalen-2-yl)-3-(4-methylphenyl)propane-1,3-dione (PubChem CID 939829) has the molecular formula C20H16O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-(1-hydroxynaphthalen-2-yl)-3-(4-methylphenyl)propane-1,3-dione.
| Compound Name | 1-(1-hydroxynaphthalen-2-yl)-3-(4-methylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 939829 |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 1-(1-hydroxynaphthalen-2-yl)-3-(4-methylphenyl)propane-1,3-dione |
| SMILES | Cc1ccc(C(=O)CC(=O)c2ccc3ccccc3c2O)cc1 |
| InChI | InChI=1S/C20H16O3/c1-13-6-8-15(9-7-13)18(21)12-19(22)17-11-10-14-4-2-3-5-16(14)20(17)23/h2-11,23H,12H2,1H3 |
| InChIKey | OFLYODVLPDSQIN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|