C35H36N4O3S — CID 172984079
N-[(E)-1-(1-hydroxynaphthalen-2-yl)ethylideneamino]ethanethioamide;N-[(E)-1-(1-hydroxynaphthalen-2-yl)ethylideneamino]-4-methylbenzamide;methane (PubChem CID 172984079) has the molecular formula C35H36N4O3S and a molecular weight of 592.77 g/mol. Its IUPAC name is N-[(E)-1-(1-hydroxynaphthalen-2-yl)ethylideneamino]ethanethioamide;N-[(E)-1-(1-hydroxynaphthalen-2-yl)ethylideneamino]-4-methylbenzamide;methane.
| Compound Name | N-[(E)-1-(1-hydroxynaphthalen-2-yl)ethylideneamino]ethanethioamide;N-[(E)-1-(1-hydroxynaphthalen-2-yl)ethylideneamino]-4-methylbenzamide;methane |
|---|---|
| PubChem CID | 172984079 |
| Molecular Formula | C35H36N4O3S |
| Molecular Weight | 592.77 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | N-[(E)-1-(1-hydroxynaphthalen-2-yl)ethylideneamino]ethanethioamide;N-[(E)-1-(1-hydroxynaphthalen-2-yl)ethylideneamino]-4-methylbenzamide;methane |
| SMILES | C.C/C(=N\NC(=O)c1ccc(C)cc1)c1ccc2ccccc2c1O.CC(=S)N/N=C(\C)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C20H18N2O2.C14H14N2OS.CH4/c1-13-7-9-16(10-8-13)20(24)22-21-14(2)17-12-11-15-5-3-4-6-18(15)19(17)23;1-9(15-16-10(2)18)12-8-7-11-5-3-4-6-13(11)14(12)17;/h3-12,23H,1-2H3,(H,22,24);3-8,17H,1-2H3,(H,16,18);1H4/b21-14+;15-9+; |
| InChIKey | DETJSYIVIBSODJ-BEBCJHEASA-N |
| XLogP | 7.85 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.77 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|