C13H13NO — CID 135790005
2-(C,N-dimethylcarbonimidoyl)naphthalen-1-ol (PubChem CID 135790005) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-(C,N-dimethylcarbonimidoyl)naphthalen-1-ol.
| Compound Name | 2-(C,N-dimethylcarbonimidoyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 135790005 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-(C,N-dimethylcarbonimidoyl)naphthalen-1-ol |
| SMILES | C/N=C(\C)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C13H13NO/c1-9(14-2)11-8-7-10-5-3-4-6-12(10)13(11)15/h3-8,15H,1-2H3/b14-9+ |
| InChIKey | VERMPIURIXEWKY-NTEUORMPSA-N |
| XLogP | 2.98 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|