About 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride
1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride (PubChem CID 174494917) has the molecular formula C12H10Cl3O2V-3
and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride.
Molecular Properties
| Compound Name | 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride |
| PubChem CID | 174494917 |
| Molecular Formula | C12H10Cl3O2V-3 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 341.92 |
| IUPAC Name | 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride |
| SMILES | CC(=O)c1ccc2ccccc2c1O.[Cl-].[Cl-].[Cl-].[V] |
| InChI | InChI=1S/C12H10O2.3ClH.V/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14;;;;/h2-7,14H,1H3;3*1H;/p-3 |
| InChIKey | QACONVBKYDNTTD-UHFFFAOYSA-K |
| XLogP | -6.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | -6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride?
The IUPAC name of 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride (CID 174494917) is 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride.
What is the SMILES notation for 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride?
The canonical SMILES for 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride is CC(=O)c1ccc2ccccc2c1O.[Cl-].[Cl-].[Cl-].[V].
What is the InChIKey of 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride?
The InChIKey is QACONVBKYDNTTD-UHFFFAOYSA-K. The full InChI is InChI=1S/C12H10O2.3ClH.V/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14;;;;/h2-7,14H,1H3;3*1H;/p-3.
What are the key properties of 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride?
1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride has a molecular weight of 343.51 g/mol, XLogP of -6.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxynaphthalen-2-yl)ethanone;vanadium;trichloride is sourced from PubChem (CID 174494917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).