About 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione
1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione (PubChem CID 141317727) has the molecular formula C21H18O5
and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione.
Molecular Properties
| Compound Name | 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione |
| PubChem CID | 141317727 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione |
| SMILES | COc1cccc(C(=O)CC(=O)c2ccc3ccccc3c2O)c1OC |
| InChI | InChI=1S/C21H18O5/c1-25-19-9-5-8-16(21(19)26-2)18(23)12-17(22)15-11-10-13-6-3-4-7-14(13)20(15)24/h3-11,24H,12H2,1-2H3 |
| InChIKey | FDLMNNNPJNZQAO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione?
The IUPAC name of 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione (CID 141317727) is 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione.
What is the SMILES notation for 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione?
The canonical SMILES for 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione is COc1cccc(C(=O)CC(=O)c2ccc3ccccc3c2O)c1OC.
What is the InChIKey of 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione?
The InChIKey is FDLMNNNPJNZQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18O5/c1-25-19-9-5-8-16(21(19)26-2)18(23)12-17(22)15-11-10-13-6-3-4-7-14(13)20(15)24/h3-11,24H,12H2,1-2H3.
What are the key properties of 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione?
1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione has a molecular weight of 350.37 g/mol, XLogP of 4.02, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione is sourced from PubChem (CID 141317727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).