C21H18O5 — CID 141317727
1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione (PubChem CID 141317727) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione.
| Compound Name | 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 141317727 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-3-(1-hydroxynaphthalen-2-yl)propane-1,3-dione |
| SMILES | COc1cccc(C(=O)CC(=O)c2ccc3ccccc3c2O)c1OC |
| InChI | InChI=1S/C21H18O5/c1-25-19-9-5-8-16(21(19)26-2)18(23)12-17(22)15-11-10-13-6-3-4-7-14(13)20(15)24/h3-11,24H,12H2,1-2H3 |
| InChIKey | FDLMNNNPJNZQAO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|