About methanol;1-methoxynaphthalene;neptunium
methanol;1-methoxynaphthalene;neptunium (PubChem CID 157299455) has the molecular formula C12H14NpO2
and a molecular weight of 427.24 g/mol. Its IUPAC name is methanol;1-methoxynaphthalene;neptunium.
Molecular Properties
| Compound Name | methanol;1-methoxynaphthalene;neptunium |
| PubChem CID | 157299455 |
| Molecular Formula | C12H14NpO2 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | methanol;1-methoxynaphthalene;neptunium |
| SMILES | CO.COc1cccc2ccccc12.[Np] |
| InChI | InChI=1S/C11H10O.CH4O.Np/c1-12-11-8-4-6-9-5-2-3-7-10(9)11;1-2;/h2-8H,1H3;2H,1H3; |
| InChIKey | QXXKFOBNKMQUTL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanol;1-methoxynaphthalene;neptunium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;1-methoxynaphthalene;neptunium?
The IUPAC name of methanol;1-methoxynaphthalene;neptunium (CID 157299455) is methanol;1-methoxynaphthalene;neptunium.
What is the SMILES notation for methanol;1-methoxynaphthalene;neptunium?
The canonical SMILES for methanol;1-methoxynaphthalene;neptunium is CO.COc1cccc2ccccc12.[Np].
What is the InChIKey of methanol;1-methoxynaphthalene;neptunium?
The InChIKey is QXXKFOBNKMQUTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O.CH4O.Np/c1-12-11-8-4-6-9-5-2-3-7-10(9)11;1-2;/h2-8H,1H3;2H,1H3;.
What are the key properties of methanol;1-methoxynaphthalene;neptunium?
methanol;1-methoxynaphthalene;neptunium has a molecular weight of 427.24 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;1-methoxynaphthalene;neptunium is sourced from PubChem (CID 157299455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).