About 1-methoxynaphthalene;oxetane
1-methoxynaphthalene;oxetane (PubChem CID 90030663) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-methoxynaphthalene;oxetane.
Molecular Properties
| Compound Name | 1-methoxynaphthalene;oxetane |
| PubChem CID | 90030663 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 1-methoxynaphthalene;oxetane |
| SMILES | C1COC1.COc1cccc2ccccc12 |
| InChI | InChI=1S/C11H10O.C3H6O/c1-12-11-8-4-6-9-5-2-3-7-10(9)11;1-2-4-3-1/h2-8H,1H3;1-3H2 |
| InChIKey | HQPYFYSXDHEXTC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxynaphthalene;oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxynaphthalene;oxetane?
The IUPAC name of 1-methoxynaphthalene;oxetane (CID 90030663) is 1-methoxynaphthalene;oxetane.
What is the SMILES notation for 1-methoxynaphthalene;oxetane?
The canonical SMILES for 1-methoxynaphthalene;oxetane is C1COC1.COc1cccc2ccccc12.
What is the InChIKey of 1-methoxynaphthalene;oxetane?
The InChIKey is HQPYFYSXDHEXTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O.C3H6O/c1-12-11-8-4-6-9-5-2-3-7-10(9)11;1-2-4-3-1/h2-8H,1H3;1-3H2.
What are the key properties of 1-methoxynaphthalene;oxetane?
1-methoxynaphthalene;oxetane has a molecular weight of 216.28 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxynaphthalene;oxetane is sourced from PubChem (CID 90030663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).