About 4-methoxy-2-benzofuran
4-methoxy-2-benzofuran (PubChem CID 21318708) has the molecular formula C9H8O2
and a molecular weight of 148.16 g/mol. Its IUPAC name is 4-methoxy-2-benzofuran.
Molecular Properties
| Compound Name | 4-methoxy-2-benzofuran |
| PubChem CID | 21318708 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 4-methoxy-2-benzofuran |
| SMILES | COc1cccc2cocc12 |
| InChI | InChI=1S/C9H8O2/c1-10-9-4-2-3-7-5-11-6-8(7)9/h2-6H,1H3 |
| InChIKey | VBIILBXDRMFMDD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-benzofuran?
The IUPAC name of 4-methoxy-2-benzofuran (CID 21318708) is 4-methoxy-2-benzofuran.
What is the SMILES notation for 4-methoxy-2-benzofuran?
The canonical SMILES for 4-methoxy-2-benzofuran is COc1cccc2cocc12.
What is the InChIKey of 4-methoxy-2-benzofuran?
The InChIKey is VBIILBXDRMFMDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2/c1-10-9-4-2-3-7-5-11-6-8(7)9/h2-6H,1H3.
What are the key properties of 4-methoxy-2-benzofuran?
4-methoxy-2-benzofuran has a molecular weight of 148.16 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-benzofuran is sourced from PubChem (CID 21318708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).