About CID 66772828
CID 66772828 (PubChem CID 66772828) has the molecular formula C8H9O2Si
and a molecular weight of 165.24 g/mol.
Molecular Properties
| Compound Name | CID 66772828 |
| PubChem CID | 66772828 |
| Molecular Formula | C8H9O2Si |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | — |
| SMILES | COc1cccc([Si])c1OC |
| InChI | InChI=1S/C8H9O2Si/c1-9-6-4-3-5-7(11)8(6)10-2/h3-5H,1-2H3 |
| InChIKey | QKOPJKATXWCMFJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66772828 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66772828?
The IUPAC name of CID 66772828 (CID 66772828) is not available.
What is the SMILES notation for CID 66772828?
The canonical SMILES for CID 66772828 is COc1cccc([Si])c1OC.
What is the InChIKey of CID 66772828?
The InChIKey is QKOPJKATXWCMFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9O2Si/c1-9-6-4-3-5-7(11)8(6)10-2/h3-5H,1-2H3.
What are the key properties of CID 66772828?
CID 66772828 has a molecular weight of 165.24 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66772828 is sourced from PubChem (CID 66772828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).