C11H14O2 — CID 22923325
1-cyclopropyl-2,3-dimethoxybenzene (PubChem CID 22923325) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-cyclopropyl-2,3-dimethoxybenzene.
| Compound Name | 1-cyclopropyl-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 22923325 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 1-cyclopropyl-2,3-dimethoxybenzene |
| SMILES | COc1cccc(C2CC2)c1OC |
| InChI | InChI=1S/C11H14O2/c1-12-10-5-3-4-9(8-6-7-8)11(10)13-2/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | YJFIACMCBLONLV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |