C11H16ClNO2 — CID 171197120
(2R)-2-(2,3-dimethoxyphenyl)azetidine;hydrochloride (PubChem CID 171197120) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is (2R)-2-(2,3-dimethoxyphenyl)azetidine;hydrochloride.
| Compound Name | (2R)-2-(2,3-dimethoxyphenyl)azetidine;hydrochloride |
|---|---|
| PubChem CID | 171197120 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (2R)-2-(2,3-dimethoxyphenyl)azetidine;hydrochloride |
| SMILES | COc1cccc([C@H]2CCN2)c1OC.Cl |
| InChI | InChI=1S/C11H15NO2.ClH/c1-13-10-5-3-4-8(11(10)14-2)9-6-7-12-9;/h3-5,9,12H,6-7H2,1-2H3;1H/t9-;/m1./s1 |
| InChIKey | PTBMIDQNIGTADV-SBSPUUFOSA-N |
| XLogP | 2.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |