C14H22ClNO3 — CID 171195335
(2R)-2-(2,3,4-trimethoxyphenyl)piperidine;hydrochloride (PubChem CID 171195335) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is (2R)-2-(2,3,4-trimethoxyphenyl)piperidine;hydrochloride.
| Compound Name | (2R)-2-(2,3,4-trimethoxyphenyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 171195335 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (2R)-2-(2,3,4-trimethoxyphenyl)piperidine;hydrochloride |
| SMILES | COc1ccc([C@H]2CCCCN2)c(OC)c1OC.Cl |
| InChI | InChI=1S/C14H21NO3.ClH/c1-16-12-8-7-10(11-6-4-5-9-15-11)13(17-2)14(12)18-3;/h7-8,11,15H,4-6,9H2,1-3H3;1H/t11-;/m1./s1 |
| InChIKey | BBNCDXHRKWOZTE-RFVHGSKJSA-N |
| XLogP | 2.95 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |