C12H16ClNO2 — CID 66519603
(2S)-2-(2-chloro-3,4-dimethoxyphenyl)pyrrolidine (PubChem CID 66519603) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is (2S)-2-(2-chloro-3,4-dimethoxyphenyl)pyrrolidine.
| Compound Name | (2S)-2-(2-chloro-3,4-dimethoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 66519603 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (2S)-2-(2-chloro-3,4-dimethoxyphenyl)pyrrolidine |
| SMILES | COc1ccc([C@@H]2CCCN2)c(Cl)c1OC |
| InChI | InChI=1S/C12H16ClNO2/c1-15-10-6-5-8(9-4-3-7-14-9)11(13)12(10)16-2/h5-6,9,14H,3-4,7H2,1-2H3/t9-/m0/s1 |
| InChIKey | SOGMWNYCGXEVDC-VIFPVBQESA-N |
| XLogP | 2.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |