C12H17NO2 — CID 94557662
[(1S,2S)-2-(2,3-dimethoxyphenyl)cyclopropyl]methanamine (PubChem CID 94557662) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is [(1S,2S)-2-(2,3-dimethoxyphenyl)cyclopropyl]methanamine.
| Compound Name | [(1S,2S)-2-(2,3-dimethoxyphenyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 94557662 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | [(1S,2S)-2-(2,3-dimethoxyphenyl)cyclopropyl]methanamine |
| SMILES | COc1cccc([C@H]2C[C@@H]2CN)c1OC |
| InChI | InChI=1S/C12H17NO2/c1-14-11-5-3-4-9(12(11)15-2)10-6-8(10)7-13/h3-5,8,10H,6-7,13H2,1-2H3/t8-,10+/m1/s1 |
| InChIKey | UEPSALDSZBPAMV-SCZZXKLOSA-N |
| XLogP | 1.77 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |