C10H13NO — CID 39235873
cis-(1R,2R)-2-(2-methoxyphenyl)cyclopropan-1-amine (PubChem CID 39235873) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is cis-(1R,2R)-2-(2-methoxyphenyl)cyclopropan-1-amine.
| Compound Name | cis-(1R,2R)-2-(2-methoxyphenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 39235873 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | cis-(1R,2R)-2-(2-methoxyphenyl)cyclopropan-1-amine |
| SMILES | COc1ccccc1[C@H]1C[C@H]1N |
| InChI | InChI=1S/C10H13NO/c1-12-10-5-3-2-4-7(10)8-6-9(8)11/h2-5,8-9H,6,11H2,1H3/t8-,9-/m1/s1 |
| InChIKey | DHHVOLWFZZZOCA-RKDXNWHRSA-N |
| XLogP | 1.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |