C11H15NO — CID 39236736
cis-(1R,2R)-2-(2-ethoxyphenyl)cyclopropan-1-amine (PubChem CID 39236736) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is cis-(1R,2R)-2-(2-ethoxyphenyl)cyclopropan-1-amine.
| Compound Name | cis-(1R,2R)-2-(2-ethoxyphenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 39236736 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | cis-(1R,2R)-2-(2-ethoxyphenyl)cyclopropan-1-amine |
| SMILES | CCOc1ccccc1[C@H]1C[C@H]1N |
| InChI | InChI=1S/C11H15NO/c1-2-13-11-6-4-3-5-8(11)9-7-10(9)12/h3-6,9-10H,2,7,12H2,1H3/t9-,10-/m1/s1 |
| InChIKey | RFMFVIFQVFBMHN-NXEZZACHSA-N |
| XLogP | 1.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |