C11H15NO2 — CID 39238725
trans-(1S,2R)-2-(2,4-dimethoxyphenyl)cyclopropan-1-amine (PubChem CID 39238725) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is trans-(1S,2R)-2-(2,4-dimethoxyphenyl)cyclopropan-1-amine.
| Compound Name | trans-(1S,2R)-2-(2,4-dimethoxyphenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 39238725 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | trans-(1S,2R)-2-(2,4-dimethoxyphenyl)cyclopropan-1-amine |
| SMILES | COc1ccc([C@H]2C[C@@H]2N)c(OC)c1 |
| InChI | InChI=1S/C11H15NO2/c1-13-7-3-4-8(9-6-10(9)12)11(5-7)14-2/h3-5,9-10H,6,12H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | CALGMPPSDMTLDR-ZJUUUORDSA-N |
| XLogP | 1.52 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |