C13H18N2O3 — CID 64541230
5-amino-6-(2,4-dimethoxyphenyl)piperidin-2-one (PubChem CID 64541230) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 5-amino-6-(2,4-dimethoxyphenyl)piperidin-2-one.
| Compound Name | 5-amino-6-(2,4-dimethoxyphenyl)piperidin-2-one |
|---|---|
| PubChem CID | 64541230 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 5-amino-6-(2,4-dimethoxyphenyl)piperidin-2-one |
| SMILES | COc1ccc(C2NC(=O)CCC2N)c(OC)c1 |
| InChI | InChI=1S/C13H18N2O3/c1-17-8-3-4-9(11(7-8)18-2)13-10(14)5-6-12(16)15-13/h3-4,7,10,13H,5-6,14H2,1-2H3,(H,15,16) |
| InChIKey | CTLDWIDECKMHKP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |