C13H18N2O3 — CID 82297415
7-(2,4-dimethoxyphenyl)-1,4-diazepan-5-one (PubChem CID 82297415) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 7-(2,4-dimethoxyphenyl)-1,4-diazepan-5-one.
| Compound Name | 7-(2,4-dimethoxyphenyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 82297415 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 7-(2,4-dimethoxyphenyl)-1,4-diazepan-5-one |
| SMILES | COc1ccc(C2CC(=O)NCCN2)c(OC)c1 |
| InChI | InChI=1S/C13H18N2O3/c1-17-9-3-4-10(12(7-9)18-2)11-8-13(16)15-6-5-14-11/h3-4,7,11,14H,5-6,8H2,1-2H3,(H,15,16) |
| InChIKey | UQXWTKGZUJHZRY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |