C12H19ClN2O2 — CID 171194245
(2R)-2-(2,4-dimethoxyphenyl)piperazine;hydrochloride (PubChem CID 171194245) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is (2R)-2-(2,4-dimethoxyphenyl)piperazine;hydrochloride.
| Compound Name | (2R)-2-(2,4-dimethoxyphenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 171194245 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (2R)-2-(2,4-dimethoxyphenyl)piperazine;hydrochloride |
| SMILES | COc1ccc([C@@H]2CNCCN2)c(OC)c1.Cl |
| InChI | InChI=1S/C12H18N2O2.ClH/c1-15-9-3-4-10(12(7-9)16-2)11-8-13-5-6-14-11;/h3-4,7,11,13-14H,5-6,8H2,1-2H3;1H/t11-;/m0./s1 |
| InChIKey | HBZTXSDVJXRQOY-MERQFXBCSA-N |
| XLogP | 1.36 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |