C11H14F2N2O — CID 116856206
2-(2,5-difluoro-4-methoxyphenyl)piperazine (PubChem CID 116856206) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-(2,5-difluoro-4-methoxyphenyl)piperazine.
| Compound Name | 2-(2,5-difluoro-4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 116856206 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-(2,5-difluoro-4-methoxyphenyl)piperazine |
| SMILES | COc1cc(F)c(C2CNCCN2)cc1F |
| InChI | InChI=1S/C11H14F2N2O/c1-16-11-5-8(12)7(4-9(11)13)10-6-14-2-3-15-10/h4-5,10,14-15H,2-3,6H2,1H3 |
| InChIKey | IASHJDLGARTVBX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |