C12H19ClN2 — CID 171194638
(2R)-2-(2,4-dimethylphenyl)piperazine;hydrochloride (PubChem CID 171194638) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is (2R)-2-(2,4-dimethylphenyl)piperazine;hydrochloride.
| Compound Name | (2R)-2-(2,4-dimethylphenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 171194638 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (2R)-2-(2,4-dimethylphenyl)piperazine;hydrochloride |
| SMILES | Cc1ccc([C@@H]2CNCCN2)c(C)c1.Cl |
| InChI | InChI=1S/C12H18N2.ClH/c1-9-3-4-11(10(2)7-9)12-8-13-5-6-14-12;/h3-4,7,12-14H,5-6,8H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | VWSMOGLSJNJNTL-YDALLXLXSA-N |
| XLogP | 1.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |