C12H18N2 — CID 55264314
(2S)-2-(2,4-dimethylphenyl)piperazine (PubChem CID 55264314) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (2S)-2-(2,4-dimethylphenyl)piperazine.
| Compound Name | (2S)-2-(2,4-dimethylphenyl)piperazine |
|---|---|
| PubChem CID | 55264314 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (2S)-2-(2,4-dimethylphenyl)piperazine |
| SMILES | Cc1ccc([C@H]2CNCCN2)c(C)c1 |
| InChI | InChI=1S/C12H18N2/c1-9-3-4-11(10(2)7-9)12-8-13-5-6-14-12/h3-4,7,12-14H,5-6,8H2,1-2H3/t12-/m1/s1 |
| InChIKey | XRFFLIAWYLCZFV-GFCCVEGCSA-N |
| XLogP | 1.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |