C10H15ClN2O2 — CID 171193580
4-[(2S)-piperazin-2-yl]benzene-1,3-diol;hydrochloride (PubChem CID 171193580) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. Its IUPAC name is 4-[(2S)-piperazin-2-yl]benzene-1,3-diol;hydrochloride.
| Compound Name | 4-[(2S)-piperazin-2-yl]benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 171193580 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 4-[(2S)-piperazin-2-yl]benzene-1,3-diol;hydrochloride |
| SMILES | Cl.Oc1ccc([C@H]2CNCCN2)c(O)c1 |
| InChI | InChI=1S/C10H14N2O2.ClH/c13-7-1-2-8(10(14)5-7)9-6-11-3-4-12-9;/h1-2,5,9,11-14H,3-4,6H2;1H/t9-;/m1./s1 |
| InChIKey | ZZJXIEHGAZTARY-SBSPUUFOSA-N |
| XLogP | 0.75 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|