C12H13ClF6N2 — CID 171194540
(2R)-2-[2,4-bis(trifluoromethyl)phenyl]piperazine;hydrochloride (PubChem CID 171194540) has the molecular formula C12H13ClF6N2 and a molecular weight of 334.69 g/mol. Its IUPAC name is (2R)-2-[2,4-bis(trifluoromethyl)phenyl]piperazine;hydrochloride.
| Compound Name | (2R)-2-[2,4-bis(trifluoromethyl)phenyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171194540 |
| Molecular Formula | C12H13ClF6N2 |
| Molecular Weight | 334.69 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (2R)-2-[2,4-bis(trifluoromethyl)phenyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccc([C@@H]2CNCCN2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F6N2.ClH/c13-11(14,15)7-1-2-8(9(5-7)12(16,17)18)10-6-19-3-4-20-10;/h1-2,5,10,19-20H,3-4,6H2;1H/t10-;/m0./s1 |
| InChIKey | HUDCMDVJFKNXOK-PPHPATTJSA-N |
| XLogP | 3.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |