C12H11F6NO — CID 171192773
(3R)-3-[2,4-bis(trifluoromethyl)phenyl]morpholine (PubChem CID 171192773) has the molecular formula C12H11F6NO and a molecular weight of 299.21 g/mol. Its IUPAC name is (3R)-3-[2,4-bis(trifluoromethyl)phenyl]morpholine.
| Compound Name | (3R)-3-[2,4-bis(trifluoromethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 171192773 |
| Molecular Formula | C12H11F6NO |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | (3R)-3-[2,4-bis(trifluoromethyl)phenyl]morpholine |
| SMILES | FC(F)(F)c1ccc([C@@H]2COCCN2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F6NO/c13-11(14,15)7-1-2-8(9(5-7)12(16,17)18)10-6-20-4-3-19-10/h1-2,5,10,19H,3-4,6H2/t10-/m0/s1 |
| InChIKey | RYRWPPHYBCPPRM-JTQLQIEISA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |