C12H11F6N — CID 171196029
(2R)-2-[2,4-bis(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 171196029) has the molecular formula C12H11F6N and a molecular weight of 283.22 g/mol. Its IUPAC name is (2R)-2-[2,4-bis(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | (2R)-2-[2,4-bis(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 171196029 |
| Molecular Formula | C12H11F6N |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (2R)-2-[2,4-bis(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | FC(F)(F)c1ccc([C@H]2CCCN2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F6N/c13-11(14,15)7-3-4-8(10-2-1-5-19-10)9(6-7)12(16,17)18/h3-4,6,10,19H,1-2,5H2/t10-/m1/s1 |
| InChIKey | JROOKKQCHIXORP-SNVBAGLBSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |