C13H17ClF3NO — CID 171195272
(2S)-2-[2-methoxy-4-(trifluoromethyl)phenyl]piperidine;hydrochloride (PubChem CID 171195272) has the molecular formula C13H17ClF3NO and a molecular weight of 295.73 g/mol. Its IUPAC name is (2S)-2-[2-methoxy-4-(trifluoromethyl)phenyl]piperidine;hydrochloride.
| Compound Name | (2S)-2-[2-methoxy-4-(trifluoromethyl)phenyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 171195272 |
| Molecular Formula | C13H17ClF3NO |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (2S)-2-[2-methoxy-4-(trifluoromethyl)phenyl]piperidine;hydrochloride |
| SMILES | COc1cc(C(F)(F)F)ccc1[C@@H]1CCCCN1.Cl |
| InChI | InChI=1S/C13H16F3NO.ClH/c1-18-12-8-9(13(14,15)16)5-6-10(12)11-4-2-3-7-17-11;/h5-6,8,11,17H,2-4,7H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | XNVADCJBSJJOJR-MERQFXBCSA-N |
| XLogP | 3.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |