C11H13F3N2 — CID 66519144
2-[(2S)-pyrrolidin-2-yl]-6-(trifluoromethyl)aniline (PubChem CID 66519144) has the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 2-[(2S)-pyrrolidin-2-yl]-6-(trifluoromethyl)aniline.
| Compound Name | 2-[(2S)-pyrrolidin-2-yl]-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 66519144 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 2-[(2S)-pyrrolidin-2-yl]-6-(trifluoromethyl)aniline |
| SMILES | Nc1c([C@@H]2CCCN2)cccc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2/c12-11(13,14)8-4-1-3-7(10(8)15)9-5-2-6-16-9/h1,3-4,9,16H,2,5-6,15H2/t9-/m0/s1 |
| InChIKey | OZTSRGGJMXJOBU-VIFPVBQESA-N |
| XLogP | 2.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|