C17H16F3N — CID 126961273
(2S)-2-[2-[2-(trifluoromethyl)phenyl]phenyl]pyrrolidine (PubChem CID 126961273) has the molecular formula C17H16F3N and a molecular weight of 291.32 g/mol. Its IUPAC name is (2S)-2-[2-[2-(trifluoromethyl)phenyl]phenyl]pyrrolidine.
| Compound Name | (2S)-2-[2-[2-(trifluoromethyl)phenyl]phenyl]pyrrolidine |
|---|---|
| PubChem CID | 126961273 |
| Molecular Formula | C17H16F3N |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (2S)-2-[2-[2-(trifluoromethyl)phenyl]phenyl]pyrrolidine |
| SMILES | FC(F)(F)c1ccccc1-c1ccccc1[C@@H]1CCCN1 |
| InChI | InChI=1S/C17H16F3N/c18-17(19,20)15-9-4-3-7-13(15)12-6-1-2-8-14(12)16-10-5-11-21-16/h1-4,6-9,16,21H,5,10-11H2/t16-/m0/s1 |
| InChIKey | LSXDLQVCHXORSK-INIZCTEOSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |