C11H12F3NS — CID 131498853
(2R)-2-[2-(trifluoromethylsulfanyl)phenyl]pyrrolidine (PubChem CID 131498853) has the molecular formula C11H12F3NS and a molecular weight of 247.28 g/mol. Its IUPAC name is (2R)-2-[2-(trifluoromethylsulfanyl)phenyl]pyrrolidine.
| Compound Name | (2R)-2-[2-(trifluoromethylsulfanyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 131498853 |
| Molecular Formula | C11H12F3NS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (2R)-2-[2-(trifluoromethylsulfanyl)phenyl]pyrrolidine |
| SMILES | FC(F)(F)Sc1ccccc1[C@H]1CCCN1 |
| InChI | InChI=1S/C11H12F3NS/c12-11(13,14)16-10-6-2-1-4-8(10)9-5-3-7-15-9/h1-2,4,6,9,15H,3,5,7H2/t9-/m1/s1 |
| InChIKey | NOXCAACMJRHTRB-SECBINFHSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |