About (2R)-2-(2-fluorophenyl)pyrrolidine;methane
(2R)-2-(2-fluorophenyl)pyrrolidine;methane (PubChem CID 161076171) has the molecular formula C11H16FN
and a molecular weight of 181.25 g/mol. Its IUPAC name is (2R)-2-(2-fluorophenyl)pyrrolidine;methane.
Molecular Properties
| Compound Name | (2R)-2-(2-fluorophenyl)pyrrolidine;methane |
| PubChem CID | 161076171 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (2R)-2-(2-fluorophenyl)pyrrolidine;methane |
| SMILES | C.Fc1ccccc1[C@H]1CCCN1 |
| InChI | InChI=1S/C10H12FN.CH4/c11-9-5-2-1-4-8(9)10-6-3-7-12-10;/h1-2,4-5,10,12H,3,6-7H2;1H4/t10-;/m1./s1 |
| InChIKey | UFHPKNSACGLDFF-HNCPQSOCSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-(2-fluorophenyl)pyrrolidine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(2-fluorophenyl)pyrrolidine;methane?
The IUPAC name of (2R)-2-(2-fluorophenyl)pyrrolidine;methane (CID 161076171) is (2R)-2-(2-fluorophenyl)pyrrolidine;methane.
What is the SMILES notation for (2R)-2-(2-fluorophenyl)pyrrolidine;methane?
The canonical SMILES for (2R)-2-(2-fluorophenyl)pyrrolidine;methane is C.Fc1ccccc1[C@H]1CCCN1.
What is the InChIKey of (2R)-2-(2-fluorophenyl)pyrrolidine;methane?
The InChIKey is UFHPKNSACGLDFF-HNCPQSOCSA-N. The full InChI is InChI=1S/C10H12FN.CH4/c11-9-5-2-1-4-8(9)10-6-3-7-12-10;/h1-2,4-5,10,12H,3,6-7H2;1H4/t10-;/m1./s1.
What are the key properties of (2R)-2-(2-fluorophenyl)pyrrolidine;methane?
(2R)-2-(2-fluorophenyl)pyrrolidine;methane has a molecular weight of 181.25 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2-fluorophenyl)pyrrolidine;methane is sourced from PubChem (CID 161076171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).