C11H13F2NS — CID 117330926
2-[2-(difluoromethylsulfanyl)phenyl]pyrrolidine (PubChem CID 117330926) has the molecular formula C11H13F2NS and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-[2-(difluoromethylsulfanyl)phenyl]pyrrolidine.
| Compound Name | 2-[2-(difluoromethylsulfanyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 117330926 |
| Molecular Formula | C11H13F2NS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-[2-(difluoromethylsulfanyl)phenyl]pyrrolidine |
| SMILES | FC(F)Sc1ccccc1C1CCCN1 |
| InChI | InChI=1S/C11H13F2NS/c12-11(13)15-10-6-2-1-4-8(10)9-5-3-7-14-9/h1-2,4,6,9,11,14H,3,5,7H2 |
| InChIKey | BVZLVKKDCJHQNR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |