About 2-pyrrolidin-2-ylaniline;dihydrochloride
2-pyrrolidin-2-ylaniline;dihydrochloride (PubChem CID 66519278) has the molecular formula C10H16Cl2N2
and a molecular weight of 235.16 g/mol. Its IUPAC name is 2-pyrrolidin-2-ylaniline;dihydrochloride.
Molecular Properties
| Compound Name | 2-pyrrolidin-2-ylaniline;dihydrochloride |
| PubChem CID | 66519278 |
| Molecular Formula | C10H16Cl2N2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-pyrrolidin-2-ylaniline;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1C1CCCN1 |
| InChI | InChI=1S/C10H14N2.2ClH/c11-9-5-2-1-4-8(9)10-6-3-7-12-10;;/h1-2,4-5,10,12H,3,6-7,11H2;2*1H |
| InChIKey | JIGWMNUVYNDVSU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrrolidin-2-ylaniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-2-ylaniline;dihydrochloride?
The IUPAC name of 2-pyrrolidin-2-ylaniline;dihydrochloride (CID 66519278) is 2-pyrrolidin-2-ylaniline;dihydrochloride.
What is the SMILES notation for 2-pyrrolidin-2-ylaniline;dihydrochloride?
The canonical SMILES for 2-pyrrolidin-2-ylaniline;dihydrochloride is Cl.Cl.Nc1ccccc1C1CCCN1.
What is the InChIKey of 2-pyrrolidin-2-ylaniline;dihydrochloride?
The InChIKey is JIGWMNUVYNDVSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.2ClH/c11-9-5-2-1-4-8(9)10-6-3-7-12-10;;/h1-2,4-5,10,12H,3,6-7,11H2;2*1H.
What are the key properties of 2-pyrrolidin-2-ylaniline;dihydrochloride?
2-pyrrolidin-2-ylaniline;dihydrochloride has a molecular weight of 235.16 g/mol, XLogP of 2.54, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-2-ylaniline;dihydrochloride is sourced from PubChem (CID 66519278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).