C12H13F4NO — CID 171195993
(2R)-2-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrrolidine (PubChem CID 171195993) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is (2R)-2-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrrolidine.
| Compound Name | (2R)-2-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 171195993 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (2R)-2-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrrolidine |
| SMILES | FC(F)C(F)(F)Oc1ccccc1[C@H]1CCCN1 |
| InChI | InChI=1S/C12H13F4NO/c13-11(14)12(15,16)18-10-6-2-1-4-8(10)9-5-3-7-17-9/h1-2,4,6,9,11,17H,3,5,7H2/t9-/m1/s1 |
| InChIKey | BVNXXZGMVVNLMA-SECBINFHSA-N |
| XLogP | 3.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|