C12H13F4NO2 — CID 171192719
(3R)-3-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]morpholine (PubChem CID 171192719) has the molecular formula C12H13F4NO2 and a molecular weight of 279.23 g/mol. Its IUPAC name is (3R)-3-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]morpholine.
| Compound Name | (3R)-3-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]morpholine |
|---|---|
| PubChem CID | 171192719 |
| Molecular Formula | C12H13F4NO2 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (3R)-3-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]morpholine |
| SMILES | FC(F)C(F)(F)Oc1ccccc1[C@@H]1COCCN1 |
| InChI | InChI=1S/C12H13F4NO2/c13-11(14)12(15,16)19-10-4-2-1-3-8(10)9-7-18-6-5-17-9/h1-4,9,11,17H,5-7H2/t9-/m0/s1 |
| InChIKey | XSNDANUOKQCHEV-VIFPVBQESA-N |
| XLogP | 2.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|