C12H14ClF4NO2 — CID 171192722
(3R)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]morpholine;hydrochloride (PubChem CID 171192722) has the molecular formula C12H14ClF4NO2 and a molecular weight of 315.69 g/mol. Its IUPAC name is (3R)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]morpholine;hydrochloride.
| Compound Name | (3R)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 171192722 |
| Molecular Formula | C12H14ClF4NO2 |
| Molecular Weight | 315.69 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | (3R)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]morpholine;hydrochloride |
| SMILES | Cl.FC(F)C(F)(F)Oc1cccc([C@@H]2COCCN2)c1 |
| InChI | InChI=1S/C12H13F4NO2.ClH/c13-11(14)12(15,16)19-9-3-1-2-8(6-9)10-7-18-5-4-17-10;/h1-3,6,10-11,17H,4-5,7H2;1H/t10-;/m0./s1 |
| InChIKey | UVRBORJPODUBAM-PPHPATTJSA-N |
| XLogP | 3.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|