C11H12F3NO2 — CID 171259764
2-[(2R)-pyrrolidin-2-yl]-6-(trifluoromethoxy)phenol (PubChem CID 171259764) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 2-[(2R)-pyrrolidin-2-yl]-6-(trifluoromethoxy)phenol.
| Compound Name | 2-[(2R)-pyrrolidin-2-yl]-6-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 171259764 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-[(2R)-pyrrolidin-2-yl]-6-(trifluoromethoxy)phenol |
| SMILES | Oc1c(OC(F)(F)F)cccc1[C@H]1CCCN1 |
| InChI | InChI=1S/C11H12F3NO2/c12-11(13,14)17-9-5-1-3-7(10(9)16)8-4-2-6-15-8/h1,3,5,8,15-16H,2,4,6H2/t8-/m1/s1 |
| InChIKey | VPHCCYUDRFQGNT-MRVPVSSYSA-N |
| XLogP | 2.72 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|