C11H15NO2 — CID 130665742
3-[(2R)-piperidin-2-yl]benzene-1,2-diol (PubChem CID 130665742) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-[(2R)-piperidin-2-yl]benzene-1,2-diol.
| Compound Name | 3-[(2R)-piperidin-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 130665742 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-[(2R)-piperidin-2-yl]benzene-1,2-diol |
| SMILES | Oc1cccc([C@H]2CCCCN2)c1O |
| InChI | InChI=1S/C11H15NO2/c13-10-6-3-4-8(11(10)14)9-5-1-2-7-12-9/h3-4,6,9,12-14H,1-2,5,7H2/t9-/m1/s1 |
| InChIKey | KRJHUYSOXFJMPP-SECBINFHSA-N |
| XLogP | 1.91 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|