C11H15NO2 — CID 130679710
2-[(2R)-piperidin-2-yl]benzene-1,3-diol (PubChem CID 130679710) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-[(2R)-piperidin-2-yl]benzene-1,3-diol.
| Compound Name | 2-[(2R)-piperidin-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 130679710 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-[(2R)-piperidin-2-yl]benzene-1,3-diol |
| SMILES | Oc1cccc(O)c1[C@H]1CCCCN1 |
| InChI | InChI=1S/C11H15NO2/c13-9-5-3-6-10(14)11(9)8-4-1-2-7-12-8/h3,5-6,8,12-14H,1-2,4,7H2/t8-/m1/s1 |
| InChIKey | ANEOZOTWBSKWPZ-MRVPVSSYSA-N |
| XLogP | 1.91 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|