C11H16ClNO2 — CID 171195341
4-[(2R)-piperidin-2-yl]benzene-1,3-diol;hydrochloride (PubChem CID 171195341) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 4-[(2R)-piperidin-2-yl]benzene-1,3-diol;hydrochloride.
| Compound Name | 4-[(2R)-piperidin-2-yl]benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 171195341 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 4-[(2R)-piperidin-2-yl]benzene-1,3-diol;hydrochloride |
| SMILES | Cl.Oc1ccc([C@H]2CCCCN2)c(O)c1 |
| InChI | InChI=1S/C11H15NO2.ClH/c13-8-4-5-9(11(14)7-8)10-3-1-2-6-12-10;/h4-5,7,10,12-14H,1-3,6H2;1H/t10-;/m1./s1 |
| InChIKey | ZVMJAURTQUMCGY-HNCPQSOCSA-N |
| XLogP | 2.33 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|