C10H8F3NO2S — CID 171184072
(4S)-4-[2-(trifluoromethylsulfanyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 171184072) has the molecular formula C10H8F3NO2S and a molecular weight of 263.24 g/mol. Its IUPAC name is (4S)-4-[2-(trifluoromethylsulfanyl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-[2-(trifluoromethylsulfanyl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 171184072 |
| Molecular Formula | C10H8F3NO2S |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | (4S)-4-[2-(trifluoromethylsulfanyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@@H](c2ccccc2SC(F)(F)F)CO1 |
| InChI | InChI=1S/C10H8F3NO2S/c11-10(12,13)17-8-4-2-1-3-6(8)7-5-16-9(15)14-7/h1-4,7H,5H2,(H,14,15)/t7-/m1/s1 |
| InChIKey | NXFBFTACDRGWKZ-SSDOTTSWSA-N |
| XLogP | 3.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |