C13H17NO2S — CID 171184181
(4S)-4-(2-tert-butylsulfanylphenyl)-1,3-oxazolidin-2-one (PubChem CID 171184181) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is (4S)-4-(2-tert-butylsulfanylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-(2-tert-butylsulfanylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 171184181 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (4S)-4-(2-tert-butylsulfanylphenyl)-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)Sc1ccccc1[C@H]1COC(=O)N1 |
| InChI | InChI=1S/C13H17NO2S/c1-13(2,3)17-11-7-5-4-6-9(11)10-8-16-12(15)14-10/h4-7,10H,8H2,1-3H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | YDRSCNQGYVYWQQ-SNVBAGLBSA-N |
| XLogP | 3.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |